C33H37F3O3 — CID 67733779
2-[(E)-but-2-enoxy]-5-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]oxane (PubChem CID 67733779) has the molecular formula C33H37F3O3 and a molecular weight of 538.65 g/mol. Its IUPAC name is 2-[(E)-but-2-enoxy]-5-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]oxane.
| Compound Name | 2-[(E)-but-2-enoxy]-5-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]oxane |
|---|---|
| PubChem CID | 67733779 |
| Molecular Formula | C33H37F3O3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-[(E)-but-2-enoxy]-5-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]oxane |
| SMILES | C/C=C/COC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCC)c(F)c4F)cc3)cc2F)CO1 |
| InChI | InChI=1S/C33H37F3O3/c1-3-5-7-8-20-37-30-17-16-28(32(35)33(30)36)24-11-9-23(10-12-24)25-13-15-27(29(34)21-25)26-14-18-31(39-22-26)38-19-6-4-2/h4,6,9-13,15-17,21,26,31H,3,5,7-8,14,18-20,22H2,1-2H3/b6-4+ |
| InChIKey | PEKATBIOZUNGBI-GQCTYLIASA-N |
| XLogP | 9.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|