C33H36F4O3 — CID 77344187
5-but-2-enoxy-2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2,3-difluorophenyl]oxane (PubChem CID 77344187) has the molecular formula C33H36F4O3 and a molecular weight of 556.64 g/mol. Its IUPAC name is 5-but-2-enoxy-2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-but-2-enoxy-2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 77344187 |
| Molecular Formula | C33H36F4O3 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 5-but-2-enoxy-2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2,3-difluorophenyl]oxane |
| SMILES | CC=CCOC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C33H36F4O3/c1-3-5-7-8-20-39-29-18-16-26(31(35)33(29)37)23-11-9-22(10-12-23)25-14-15-27(32(36)30(25)34)28-17-13-24(21-40-28)38-19-6-4-2/h4,6,9-12,14-16,18,24,28H,3,5,7-8,13,17,19-21H2,1-2H3 |
| InChIKey | IAOHOYPLCWWDKD-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|