C21H23F3O3 — CID 126764647
5-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-2-propoxyoxane (PubChem CID 126764647) has the molecular formula C21H23F3O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-2-propoxyoxane.
| Compound Name | 5-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-2-propoxyoxane |
|---|---|
| PubChem CID | 126764647 |
| Molecular Formula | C21H23F3O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-2-propoxyoxane |
| SMILES | CCCOC1CCC(c2ccc(-c3ccc(OC)c(F)c3F)cc2F)CO1 |
| InChI | InChI=1S/C21H23F3O3/c1-3-10-26-19-9-5-14(12-27-19)15-6-4-13(11-17(15)22)16-7-8-18(25-2)21(24)20(16)23/h4,6-8,11,14,19H,3,5,9-10,12H2,1-2H3 |
| InChIKey | IPBCHKUMETXADP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |