C23H27F3O3 — CID 126764924
5-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]-2-pentoxyoxane (PubChem CID 126764924) has the molecular formula C23H27F3O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]-2-pentoxyoxane.
| Compound Name | 5-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]-2-pentoxyoxane |
|---|---|
| PubChem CID | 126764924 |
| Molecular Formula | C23H27F3O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]-2-pentoxyoxane |
| SMILES | CCCCCOC1CCC(c2ccc(-c3ccc(OC)c(F)c3F)c(F)c2)CO1 |
| InChI | InChI=1S/C23H27F3O3/c1-3-4-5-12-28-21-11-7-16(14-29-21)15-6-8-17(19(24)13-15)18-9-10-20(27-2)23(26)22(18)25/h6,8-10,13,16,21H,3-5,7,11-12,14H2,1-2H3 |
| InChIKey | ZLKMESFBZJIDJW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|