C22H25F3O3 — CID 126764785
5-butoxy-2-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]oxane (PubChem CID 126764785) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is 5-butoxy-2-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]oxane.
| Compound Name | 5-butoxy-2-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]oxane |
|---|---|
| PubChem CID | 126764785 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-butoxy-2-[4-(2,3-difluoro-4-methoxyphenyl)-3-fluorophenyl]oxane |
| SMILES | CCCCOC1CCC(c2ccc(-c3ccc(OC)c(F)c3F)c(F)c2)OC1 |
| InChI | InChI=1S/C22H25F3O3/c1-3-4-11-27-15-6-9-19(28-13-15)14-5-7-16(18(23)12-14)17-8-10-20(26-2)22(25)21(17)24/h5,7-8,10,12,15,19H,3-4,6,9,11,13H2,1-2H3 |
| InChIKey | JZBMBKRBPVGTNH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|