C27H25F3O2 — CID 67732287
2-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenyl]-5-[(E)-prop-1-enyl]oxane (PubChem CID 67732287) has the molecular formula C27H25F3O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenyl]-5-[(E)-prop-1-enyl]oxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenyl]-5-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 67732287 |
| Molecular Formula | C27H25F3O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenyl]-5-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(-c4ccc(OC)c(F)c4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C27H25F3O2/c1-3-4-17-5-13-24(32-16-17)20-10-11-21(23(28)15-20)18-6-8-19(9-7-18)22-12-14-25(31-2)27(30)26(22)29/h3-4,6-12,14-15,17,24H,5,13,16H2,1-2H3/b4-3+ |
| InChIKey | XZXLVEQCEMDOFE-ONEGZZNKSA-N |
| XLogP | 7.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|