C34H39F3O2 — CID 77344034
2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-prop-1-enyloxane (PubChem CID 77344034) has the molecular formula C34H39F3O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-prop-1-enyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-prop-1-enyloxane |
|---|---|
| PubChem CID | 77344034 |
| Molecular Formula | C34H39F3O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-prop-1-enyloxane |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCCCC)c(F)c4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C34H39F3O2/c1-3-5-6-7-8-9-21-38-32-20-18-29(33(36)34(32)37)26-14-12-25(13-15-26)28-17-16-27(22-30(28)35)31-19-11-24(10-4-2)23-39-31/h4,10,12-18,20,22,24,31H,3,5-9,11,19,21,23H2,1-2H3 |
| InChIKey | HQQGRQKAXGPGOH-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|