C29H29F3O2 — CID 67732599
2-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane (PubChem CID 67732599) has the molecular formula C29H29F3O2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 67732599 |
| Molecular Formula | C29H29F3O2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(-c4ccc(OCCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C29H29F3O2/c1-3-5-19-6-14-26(34-18-19)24-12-11-22(17-25(24)30)20-7-9-21(10-8-20)23-13-15-27(33-16-4-2)29(32)28(23)31/h3,5,7-13,15,17,19,26H,4,6,14,16,18H2,1-2H3/b5-3+ |
| InChIKey | RKZRMJOQBQPTKB-HWKANZROSA-N |
| XLogP | 8.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|