C29H29BF3O3 — CID 70820769
CID 70820769 (PubChem CID 70820769) has the molecular formula C29H29BF3O3 and a molecular weight of 493.35 g/mol.
| Compound Name | CID 70820769 |
|---|---|
| PubChem CID | 70820769 |
| Molecular Formula | C29H29BF3O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | — |
| SMILES | C/C=C\CCOc1ccc(-c2ccc(-c3ccc(C4CCC(C[B]O)CO4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C29H29BF3O3/c1-2-3-4-15-35-27-14-12-23(28(32)29(27)33)21-8-6-20(7-9-21)22-10-11-24(25(31)16-22)26-13-5-19(17-30-34)18-36-26/h2-3,6-12,14,16,19,26,34H,4-5,13,15,17-18H2,1H3/b3-2- |
| InChIKey | YRTKPXNSGYNYEU-IHWYPQMZSA-N |
| XLogP | 7.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|