C31H33F3O3 — CID 67734958
2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane (PubChem CID 67734958) has the molecular formula C31H33F3O3 and a molecular weight of 510.60 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67734958 |
| Molecular Formula | C31H33F3O3 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(c2ccc(-c3ccc(-c4ccc(OCCCCCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C31H33F3O3/c1-3-5-6-7-17-35-28-16-15-25(29(33)30(28)34)23-11-9-22(10-12-23)24-13-14-26(27(32)18-24)31-36-19-21(8-4-2)20-37-31/h4,8-16,18,21,31H,3,5-7,17,19-20H2,1-2H3/b8-4+ |
| InChIKey | LSYVENFCAJOOPM-XBXARRHUSA-N |
| XLogP | 8.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|