C30H31F3O2 — CID 67734944
2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane (PubChem CID 67734944) has the molecular formula C30H31F3O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67734944 |
| Molecular Formula | C30H31F3O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(c2ccc(-c3ccc(-c4ccc(CCCCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C30H31F3O2/c1-3-5-6-8-23-13-15-25(29(33)28(23)32)22-11-9-21(10-12-22)24-14-16-26(27(31)17-24)30-34-18-20(7-4-2)19-35-30/h4,7,9-17,20,30H,3,5-6,8,18-19H2,1-2H3/b7-4+ |
| InChIKey | GRLZGRVNMQAEKU-QPJJXVBHSA-N |
| XLogP | 8.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|