C31H32F4O2 — CID 67735380
2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-ethenyl-1,3-dioxane (PubChem CID 67735380) has the molecular formula C31H32F4O2 and a molecular weight of 512.59 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-ethenyl-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-ethenyl-1,3-dioxane |
|---|---|
| PubChem CID | 67735380 |
| Molecular Formula | C31H32F4O2 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-ethenyl-1,3-dioxane |
| SMILES | C=CC1COC(c2ccc(-c3ccc(-c4ccc(CCCCCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C31H32F4O2/c1-3-5-6-7-8-9-23-14-15-24(28(33)27(23)32)21-10-12-22(13-11-21)25-16-17-26(30(35)29(25)34)31-36-18-20(4-2)19-37-31/h4,10-17,20,31H,2-3,5-9,18-19H2,1H3 |
| InChIKey | XWJDKOIQCSUVFF-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|