C32H36F4O2 — CID 67735215
2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyl-1,3-dioxane (PubChem CID 67735215) has the molecular formula C32H36F4O2 and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 67735215 |
| Molecular Formula | C32H36F4O2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyl-1,3-dioxane |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ccc(C4OCC(CCC)CO4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C32H36F4O2/c1-3-5-6-7-8-10-24-15-16-25(29(34)28(24)33)22-11-13-23(14-12-22)26-17-18-27(31(36)30(26)35)32-37-19-21(9-4-2)20-38-32/h11-18,21,32H,3-10,19-20H2,1-2H3 |
| InChIKey | BJTDGAQOJXFNDK-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|