C33H38F4O — CID 67732738
2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyloxane (PubChem CID 67732738) has the molecular formula C33H38F4O and a molecular weight of 526.66 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyloxane |
|---|---|
| PubChem CID | 67732738 |
| Molecular Formula | C33H38F4O |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-2,3-difluorophenyl]-5-propyloxane |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ccc(C4CCC(CCC)CO4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C33H38F4O/c1-3-5-6-7-8-10-25-16-17-26(31(35)30(25)34)23-12-14-24(15-13-23)27-18-19-28(33(37)32(27)36)29-20-11-22(9-4-2)21-38-29/h12-19,22,29H,3-11,20-21H2,1-2H3 |
| InChIKey | HZZZXTWGVBJMQG-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|