C33H39F3O — CID 67732475
2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-pentyloxane (PubChem CID 67732475) has the molecular formula C33H39F3O and a molecular weight of 508.67 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-pentyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-pentyloxane |
|---|---|
| PubChem CID | 67732475 |
| Molecular Formula | C33H39F3O |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-2-fluorophenyl]-5-pentyloxane |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCC)CO4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C33H39F3O/c1-3-5-7-9-23-11-20-31(37-22-23)29-19-17-27(21-30(29)34)24-12-14-25(15-13-24)28-18-16-26(10-8-6-4-2)32(35)33(28)36/h12-19,21,23,31H,3-11,20,22H2,1-2H3 |
| InChIKey | IMPRBTJJRNALLK-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|