C26H33F3O — CID 126764442
5-butyl-2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]oxane (PubChem CID 126764442) has the molecular formula C26H33F3O and a molecular weight of 418.54 g/mol. Its IUPAC name is 5-butyl-2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]oxane.
| Compound Name | 5-butyl-2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]oxane |
|---|---|
| PubChem CID | 126764442 |
| Molecular Formula | C26H33F3O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 5-butyl-2-[4-(2,3-difluoro-4-pentylphenyl)-2-fluorophenyl]oxane |
| SMILES | CCCCCc1ccc(-c2ccc(C3CCC(CCCC)CO3)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C26H33F3O/c1-3-5-7-9-19-11-13-21(26(29)25(19)28)20-12-14-22(23(27)16-20)24-15-10-18(17-30-24)8-6-4-2/h11-14,16,18,24H,3-10,15,17H2,1-2H3 |
| InChIKey | CNANIHUAMXGXPR-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|