C36H42F4O — CID 67732851
2-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane (PubChem CID 67732851) has the molecular formula C36H42F4O and a molecular weight of 566.72 g/mol. Its IUPAC name is 2-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane.
| Compound Name | 2-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 67732851 |
| Molecular Formula | C36H42F4O |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | 2-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(-c4ccc(CCCCCCCCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C36H42F4O/c1-3-5-6-7-8-9-10-11-13-28-19-20-29(34(38)33(28)37)26-15-17-27(18-16-26)30-21-22-31(36(40)35(30)39)32-23-14-25(12-4-2)24-41-32/h4,12,15-22,25,32H,3,5-11,13-14,23-24H2,1-2H3/b12-4+ |
| InChIKey | FJOXCNNWUUVVHN-UUILKARUSA-N |
| XLogP | 11.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|