C29H28F4O — CID 58535468
2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane (PubChem CID 58535468) has the molecular formula C29H28F4O and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane.
| Compound Name | 2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 58535468 |
| Molecular Formula | C29H28F4O |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]-2,3-difluorophenyl]-5-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(-c4ccc(CCC)cc4)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C29H28F4O/c1-3-5-18-7-10-20(11-8-18)21-12-13-22(27(31)26(21)30)23-14-15-24(29(33)28(23)32)25-16-9-19(6-4-2)17-34-25/h4,6-8,10-15,19,25H,3,5,9,16-17H2,1-2H3/b6-4+ |
| InChIKey | VDLCEPVAQVNKKX-GQCTYLIASA-N |
| XLogP | 8.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|