C21H21F3O2 — CID 126764549
2-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane (PubChem CID 126764549) has the molecular formula C21H21F3O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane.
| Compound Name | 2-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 126764549 |
| Molecular Formula | C21H21F3O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-methoxyphenyl)-2-fluorophenyl]-5-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(OC)c(F)c3F)cc2F)OC1 |
| InChI | InChI=1S/C21H21F3O2/c1-3-4-13-5-9-18(26-12-13)16-7-6-14(11-17(16)22)15-8-10-19(25-2)21(24)20(15)23/h3-4,6-8,10-11,13,18H,5,9,12H2,1-2H3/b4-3+ |
| InChIKey | JIDIBMGXOHPCMG-ONEGZZNKSA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|