C30H29F5O2 — CID 76815966
2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]ethyl]-5-prop-1-enyloxane (PubChem CID 76815966) has the molecular formula C30H29F5O2 and a molecular weight of 516.55 g/mol. Its IUPAC name is 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]ethyl]-5-prop-1-enyloxane.
| Compound Name | 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]ethyl]-5-prop-1-enyloxane |
|---|---|
| PubChem CID | 76815966 |
| Molecular Formula | C30H29F5O2 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]ethyl]-5-prop-1-enyloxane |
| SMILES | CC=CC1CCC(CCc2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)cc2F)OC1 |
| InChI | InChI=1S/C30H29F5O2/c1-3-5-18-6-10-21(37-17-18)11-9-19-7-8-20(16-25(19)31)22-12-13-23(28(33)27(22)32)24-14-15-26(36-4-2)30(35)29(24)34/h3,5,7-8,12-16,18,21H,4,6,9-11,17H2,1-2H3 |
| InChIKey | VOUCMJGODMTTMB-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|