C32H35F3O2 — CID 67740503
5-[(E)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethenyl]-2-pentyloxane (PubChem CID 67740503) has the molecular formula C32H35F3O2 and a molecular weight of 508.62 g/mol. Its IUPAC name is 5-[(E)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethenyl]-2-pentyloxane.
| Compound Name | 5-[(E)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethenyl]-2-pentyloxane |
|---|---|
| PubChem CID | 67740503 |
| Molecular Formula | C32H35F3O2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 5-[(E)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethenyl]-2-pentyloxane |
| SMILES | CCCCCC1CCC(/C=C/c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)cc2F)CO1 |
| InChI | InChI=1S/C32H35F3O2/c1-3-5-6-7-27-17-9-22(21-37-27)8-10-25-15-16-26(20-29(25)33)23-11-13-24(14-12-23)28-18-19-30(36-4-2)32(35)31(28)34/h8,10-16,18-20,22,27H,3-7,9,17,21H2,1-2H3/b10-8+ |
| InChIKey | BNYAKCBNIWYFTJ-CSKARUKUSA-N |
| XLogP | 9.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|