C21H21F3O2 — CID 126765337
5-ethenyl-2-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]oxane (PubChem CID 126765337) has the molecular formula C21H21F3O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-ethenyl-2-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]oxane.
| Compound Name | 5-ethenyl-2-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 126765337 |
| Molecular Formula | C21H21F3O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-ethenyl-2-[4-(4-ethoxy-3-fluorophenyl)-2,3-difluorophenyl]oxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OCC)c(F)c3)c(F)c2F)OC1 |
| InChI | InChI=1S/C21H21F3O2/c1-3-13-5-9-18(26-12-13)16-8-7-15(20(23)21(16)24)14-6-10-19(25-4-2)17(22)11-14/h3,6-8,10-11,13,18H,1,4-5,9,12H2,2H3 |
| InChIKey | ZISRUFIHNJVOKM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|