C26H22F4O3 — CID 67735388
5-ethenyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane (PubChem CID 67735388) has the molecular formula C26H22F4O3 and a molecular weight of 458.45 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane.
| Compound Name | 5-ethenyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67735388 |
| Molecular Formula | C26H22F4O3 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 5-ethenyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane |
| SMILES | C=CC1COC(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C26H22F4O3/c1-3-15-13-32-26(33-14-15)20-10-9-18(22(27)24(20)29)16-5-7-17(8-6-16)19-11-12-21(31-4-2)25(30)23(19)28/h3,5-12,15,26H,1,4,13-14H2,2H3 |
| InChIKey | NCCPYSRBVYGVGA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|