C27H24F4O2 — CID 58535777
5-ethenyl-2-[4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane (PubChem CID 58535777) has the molecular formula C27H24F4O2 and a molecular weight of 456.48 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-ethenyl-2-[4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 58535777 |
| Molecular Formula | C27H24F4O2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 5-ethenyl-2-[4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(OCC)cc4)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C27H24F4O2/c1-3-16-5-14-23(33-15-16)22-13-12-21(26(30)27(22)31)20-11-10-19(24(28)25(20)29)17-6-8-18(9-7-17)32-4-2/h3,6-13,16,23H,1,4-5,14-15H2,2H3 |
| InChIKey | DSTMMPOBGIEPCR-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|