C26H28F4O3 — CID 58535444
5-ethenyl-2-[4-[4-(6-ethoxyoxan-3-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane (PubChem CID 58535444) has the molecular formula C26H28F4O3 and a molecular weight of 464.50 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[4-(6-ethoxyoxan-3-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-ethenyl-2-[4-[4-(6-ethoxyoxan-3-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 58535444 |
| Molecular Formula | C26H28F4O3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 5-ethenyl-2-[4-[4-(6-ethoxyoxan-3-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(C4CCC(OCC)OC4)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C26H28F4O3/c1-3-15-5-11-21(32-13-15)20-10-9-19(25(29)26(20)30)18-8-7-17(23(27)24(18)28)16-6-12-22(31-4-2)33-14-16/h3,7-10,15-16,21-22H,1,4-6,11-14H2,2H3 |
| InChIKey | DBMYEBPNJKVPRV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|