C20H19F3O2 — CID 126765069
2-[2,3-difluoro-4-(2-fluoro-4-methoxyphenyl)phenyl]-5-ethenyloxane (PubChem CID 126765069) has the molecular formula C20H19F3O2 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(2-fluoro-4-methoxyphenyl)phenyl]-5-ethenyloxane.
| Compound Name | 2-[2,3-difluoro-4-(2-fluoro-4-methoxyphenyl)phenyl]-5-ethenyloxane |
|---|---|
| PubChem CID | 126765069 |
| Molecular Formula | C20H19F3O2 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[2,3-difluoro-4-(2-fluoro-4-methoxyphenyl)phenyl]-5-ethenyloxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OC)cc3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C20H19F3O2/c1-3-12-4-9-18(25-11-12)16-8-7-15(19(22)20(16)23)14-6-5-13(24-2)10-17(14)21/h3,5-8,10,12,18H,1,4,9,11H2,2H3 |
| InChIKey | YKQHVFBJBUYXEL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|