C25H31F3O2 — CID 126765014
2-[4-(4-butoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-butyloxane (PubChem CID 126765014) has the molecular formula C25H31F3O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-[4-(4-butoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-butyloxane.
| Compound Name | 2-[4-(4-butoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-butyloxane |
|---|---|
| PubChem CID | 126765014 |
| Molecular Formula | C25H31F3O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[4-(4-butoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-butyloxane |
| SMILES | CCCCOc1ccc(-c2ccc(C3CCC(CCCC)CO3)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C25H31F3O2/c1-3-5-7-17-8-13-23(30-16-17)21-12-11-20(24(27)25(21)28)19-10-9-18(15-22(19)26)29-14-6-4-2/h9-12,15,17,23H,3-8,13-14,16H2,1-2H3 |
| InChIKey | IGNMVNKQEZCLOY-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|