C22H25F3O3 — CID 126765033
2-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-propoxyoxane (PubChem CID 126765033) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-propoxyoxane.
| Compound Name | 2-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-propoxyoxane |
|---|---|
| PubChem CID | 126765033 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-5-propoxyoxane |
| SMILES | CCCOC1CCC(c2ccc(-c3ccc(OCC)cc3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C22H25F3O3/c1-3-11-27-15-6-10-20(28-13-15)18-9-8-17(21(24)22(18)25)16-7-5-14(26-4-2)12-19(16)23/h5,7-9,12,15,20H,3-4,6,10-11,13H2,1-2H3 |
| InChIKey | UVYZJOHOKYFOFV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |