C22H25F3O2 — CID 126764775
5-butoxy-2-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenyl]oxane (PubChem CID 126764775) has the molecular formula C22H25F3O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-butoxy-2-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenyl]oxane.
| Compound Name | 5-butoxy-2-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenyl]oxane |
|---|---|
| PubChem CID | 126764775 |
| Molecular Formula | C22H25F3O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 5-butoxy-2-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenyl]oxane |
| SMILES | CCCCOC1CCC(c2ccc(-c3ccc(C)c(F)c3F)c(F)c2)OC1 |
| InChI | InChI=1S/C22H25F3O2/c1-3-4-11-26-16-7-10-20(27-13-16)15-6-9-17(19(23)12-15)18-8-5-14(2)21(24)22(18)25/h5-6,8-9,12,16,20H,3-4,7,10-11,13H2,1-2H3 |
| InChIKey | KBXOFYXWTMJBPT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|