C23H25F3O2 — CID 126764559
5-butoxy-2-[4-(4-ethenyl-2,3-difluorophenyl)-2-fluorophenyl]oxane (PubChem CID 126764559) has the molecular formula C23H25F3O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 5-butoxy-2-[4-(4-ethenyl-2,3-difluorophenyl)-2-fluorophenyl]oxane.
| Compound Name | 5-butoxy-2-[4-(4-ethenyl-2,3-difluorophenyl)-2-fluorophenyl]oxane |
|---|---|
| PubChem CID | 126764559 |
| Molecular Formula | C23H25F3O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 5-butoxy-2-[4-(4-ethenyl-2,3-difluorophenyl)-2-fluorophenyl]oxane |
| SMILES | C=Cc1ccc(-c2ccc(C3CCC(OCCCC)CO3)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C23H25F3O2/c1-3-5-12-27-17-8-11-21(28-14-17)19-10-7-16(13-20(19)24)18-9-6-15(4-2)22(25)23(18)26/h4,6-7,9-10,13,17,21H,2-3,5,8,11-12,14H2,1H3 |
| InChIKey | GFLFFJNTYAULLD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|