C23H27F3O3 — CID 126765221
5-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-2-(propoxymethyl)oxane (PubChem CID 126765221) has the molecular formula C23H27F3O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-2-(propoxymethyl)oxane.
| Compound Name | 5-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-2-(propoxymethyl)oxane |
|---|---|
| PubChem CID | 126765221 |
| Molecular Formula | C23H27F3O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5-[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenyl]-2-(propoxymethyl)oxane |
| SMILES | CCCOCC1CCC(c2ccc(-c3ccc(OCC)cc3F)c(F)c2F)CO1 |
| InChI | InChI=1S/C23H27F3O3/c1-3-11-27-14-17-6-5-15(13-29-17)18-9-10-20(23(26)22(18)25)19-8-7-16(28-4-2)12-21(19)24/h7-10,12,15,17H,3-6,11,13-14H2,1-2H3 |
| InChIKey | JMNOAAYIUFIMBZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|