C26H22F4O2 — CID 67735344
5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane (PubChem CID 67735344) has the molecular formula C26H22F4O2 and a molecular weight of 442.45 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane.
| Compound Name | 5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67735344 |
| Molecular Formula | C26H22F4O2 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-1,3-dioxane |
| SMILES | C=CC1COC(c2ccc(-c3ccc(-c4ccc(CC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C26H22F4O2/c1-3-15-13-31-26(32-14-15)21-12-11-20(24(29)25(21)30)18-7-5-17(6-8-18)19-10-9-16(4-2)22(27)23(19)28/h3,5-12,15,26H,1,4,13-14H2,2H3 |
| InChIKey | GQCYRRKNUOUDEY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|