C26H23F3O2 — CID 67734515
5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-1,3-dioxane (PubChem CID 67734515) has the molecular formula C26H23F3O2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-1,3-dioxane.
| Compound Name | 5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67734515 |
| Molecular Formula | C26H23F3O2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 5-ethenyl-2-[4-[4-(4-ethyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-1,3-dioxane |
| SMILES | C=CC1COC(c2ccc(-c3ccc(-c4ccc(CC)c(F)c4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C26H23F3O2/c1-3-16-14-30-26(31-15-16)20-10-11-21(23(27)13-20)18-5-7-19(8-6-18)22-12-9-17(4-2)24(28)25(22)29/h3,5-13,16,26H,1,4,14-15H2,2H3 |
| InChIKey | WQRPEBLRMMKKHG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|