C25H23F3O3 — CID 143773092
2-[4-[4-(5,6-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-5-ethenyl-1,3-dioxane (PubChem CID 143773092) has the molecular formula C25H23F3O3 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[4-[4-(5,6-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-5-ethenyl-1,3-dioxane.
| Compound Name | 2-[4-[4-(5,6-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-5-ethenyl-1,3-dioxane |
|---|---|
| PubChem CID | 143773092 |
| Molecular Formula | C25H23F3O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[4-[4-(5,6-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-5-ethenyl-1,3-dioxane |
| SMILES | C=CC1COC(c2ccc(-c3ccc(C4=CC=C(OC)C(F)C4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C25H23F3O3/c1-3-15-13-30-25(31-14-15)18-8-9-19(21(26)12-18)16-4-6-17(7-5-16)20-10-11-22(29-2)24(28)23(20)27/h3-12,15,23-25H,1,13-14H2,2H3 |
| InChIKey | BSZORPOQFREEAF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|