C30H33F3 — CID 143773190
1-[4-(5,6-difluoro-4-pent-4-enylcyclohexa-1,3-dien-1-yl)phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene (PubChem CID 143773190) has the molecular formula C30H33F3 and a molecular weight of 450.59 g/mol. Its IUPAC name is 1-[4-(5,6-difluoro-4-pent-4-enylcyclohexa-1,3-dien-1-yl)phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-[4-(5,6-difluoro-4-pent-4-enylcyclohexa-1,3-dien-1-yl)phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 143773190 |
| Molecular Formula | C30H33F3 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-[4-(5,6-difluoro-4-pent-4-enylcyclohexa-1,3-dien-1-yl)phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene |
| SMILES | C=CCCCC1=CC=C(c2ccc(-c3ccc(C4CCC(C)CC4)cc3F)cc2)C(F)C1F |
| InChI | InChI=1S/C30H33F3/c1-3-4-5-6-24-15-18-27(30(33)29(24)32)23-13-11-22(12-14-23)26-17-16-25(19-28(26)31)21-9-7-20(2)8-10-21/h3,11-21,29-30H,1,4-10H2,2H3 |
| InChIKey | DYUNROVFSVZFLA-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|