C34H37F3O — CID 88998143
2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene (PubChem CID 88998143) has the molecular formula C34H37F3O and a molecular weight of 518.66 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 88998143 |
| Molecular Formula | C34H37F3O |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C4CCC(C5CCC(C)CC5)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C34H37F3O/c1-3-20-38-32-19-18-30(33(36)34(32)37)27-14-12-26(13-15-27)29-17-16-28(21-31(29)35)25-10-8-24(9-11-25)23-6-4-22(2)5-7-23/h3,12-19,21-25H,1,4-11,20H2,2H3 |
| InChIKey | DHMDRNZJEYMWNK-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|