C39H47F3O — CID 67737499
1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-heptoxybenzene (PubChem CID 67737499) has the molecular formula C39H47F3O and a molecular weight of 588.80 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-heptoxybenzene.
| Compound Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-heptoxybenzene |
|---|---|
| PubChem CID | 67737499 |
| Molecular Formula | C39H47F3O |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-heptoxybenzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCCCCCCC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C39H47F3O/c1-3-5-6-7-8-25-43-37-24-23-35(38(41)39(37)42)32-19-17-31(18-20-32)34-22-21-33(26-36(34)40)30-15-13-29(14-16-30)28-11-9-27(4-2)10-12-28/h4,17-24,26-30H,2-3,5-16,25H2,1H3 |
| InChIKey | BXROKYYVJMAGGW-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|