C37H41F3O — CID 88998471
1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene (PubChem CID 88998471) has the molecular formula C37H41F3O and a molecular weight of 558.73 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene.
| Compound Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene |
|---|---|
| PubChem CID | 88998471 |
| Molecular Formula | C37H41F3O |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OC/C=C/CC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C37H41F3O/c1-3-5-6-23-41-35-22-21-33(36(39)37(35)40)30-17-15-29(16-18-30)32-20-19-31(24-34(32)38)28-13-11-27(12-14-28)26-9-7-25(4-2)8-10-26/h4-6,15-22,24-28H,2-3,7-14,23H2,1H3/b6-5+ |
| InChIKey | ZCFYORLOIZAVBL-AATRIKPKSA-N |
| XLogP | 11.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|