C35H39F3 — CID 67737471
1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-propylbenzene (PubChem CID 67737471) has the molecular formula C35H39F3 and a molecular weight of 516.69 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-propylbenzene.
| Compound Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-propylbenzene |
|---|---|
| PubChem CID | 67737471 |
| Molecular Formula | C35H39F3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-propylbenzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(CCC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C35H39F3/c1-3-5-29-18-21-32(35(38)34(29)37)28-16-14-27(15-17-28)31-20-19-30(22-33(31)36)26-12-10-25(11-13-26)24-8-6-23(4-2)7-9-24/h4,14-26H,2-3,5-13H2,1H3 |
| InChIKey | VVMXNJGOLBXYKJ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|