C35H44F2 — CID 88993495
4-(4-ethenylcyclohexyl)-2-fluoro-1-[4-[4-(3-fluoro-4-propylphenyl)cyclohexyl]cyclohexen-1-yl]benzene (PubChem CID 88993495) has the molecular formula C35H44F2 and a molecular weight of 502.73 g/mol. Its IUPAC name is 4-(4-ethenylcyclohexyl)-2-fluoro-1-[4-[4-(3-fluoro-4-propylphenyl)cyclohexyl]cyclohexen-1-yl]benzene.
| Compound Name | 4-(4-ethenylcyclohexyl)-2-fluoro-1-[4-[4-(3-fluoro-4-propylphenyl)cyclohexyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 88993495 |
| Molecular Formula | C35H44F2 |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 4-(4-ethenylcyclohexyl)-2-fluoro-1-[4-[4-(3-fluoro-4-propylphenyl)cyclohexyl]cyclohexen-1-yl]benzene |
| SMILES | C=CC1CCC(c2ccc(C3=CCC(C4CCC(c5ccc(CCC)c(F)c5)CC4)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C35H44F2/c1-3-5-30-18-19-31(22-34(30)36)28-12-10-25(11-13-28)26-14-16-29(17-15-26)33-21-20-32(23-35(33)37)27-8-6-24(4-2)7-9-27/h4,16,18-28H,2-3,5-15,17H2,1H3 |
| InChIKey | ICYAOJXTUIJHQH-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|