C40H46F4 — CID 67740069
1-[4-(2,3-difluoro-4-octylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene (PubChem CID 67740069) has the molecular formula C40H46F4 and a molecular weight of 602.80 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-octylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene.
| Compound Name | 1-[4-(2,3-difluoro-4-octylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67740069 |
| Molecular Formula | C40H46F4 |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-octylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene |
| SMILES | C=CC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(CCCCCCCC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C40H46F4/c1-3-5-6-7-8-9-10-33-23-24-34(38(42)37(33)41)31-19-21-32(22-20-31)36-26-25-35(39(43)40(36)44)30-17-15-29(16-18-30)28-13-11-27(4-2)12-14-28/h4,17,19-29H,2-3,5-16,18H2,1H3 |
| InChIKey | RRTHMYWCQRDUGG-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|