C36H40F4 — CID 67731943
1-decyl-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene (PubChem CID 67731943) has the molecular formula C36H40F4 and a molecular weight of 548.71 g/mol. Its IUPAC name is 1-decyl-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-decyl-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67731943 |
| Molecular Formula | C36H40F4 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 1-decyl-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene |
| SMILES | C=CC1CC=C(c2ccc(-c3ccc(-c4ccc(CCCCCCCCCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C36H40F4/c1-3-5-6-7-8-9-10-11-12-29-21-22-30(34(38)33(29)37)27-17-19-28(20-18-27)32-24-23-31(35(39)36(32)40)26-15-13-25(4-2)14-16-26/h4,15,17-25H,2-3,5-14,16H2,1H3 |
| InChIKey | GBUONSIQIXCMGC-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|