C36H41F3 — CID 77343709
2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonylbenzene (PubChem CID 77343709) has the molecular formula C36H41F3 and a molecular weight of 530.72 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonylbenzene |
|---|---|
| PubChem CID | 77343709 |
| Molecular Formula | C36H41F3 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonylbenzene |
| SMILES | CC=CC1CC=C(c2ccc(-c3ccc(-c4ccc(CCCCCCCCC)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C36H41F3/c1-3-5-6-7-8-9-10-12-30-21-24-33(36(39)35(30)38)29-19-17-28(18-20-29)32-23-22-31(25-34(32)37)27-15-13-26(11-4-2)14-16-27/h4,11,15,17-26H,3,5-10,12-14,16H2,1-2H3 |
| InChIKey | CWEIZPHGSPXYEJ-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|