C33H34F4 — CID 67731982
1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]benzene (PubChem CID 67731982) has the molecular formula C33H34F4 and a molecular weight of 506.63 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]benzene.
| Compound Name | 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 67731982 |
| Molecular Formula | C33H34F4 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]benzene |
| SMILES | C/C=C/C1CC=C(c2ccc(-c3ccc(-c4ccc(CCCCCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C33H34F4/c1-3-5-6-7-9-26-18-19-27(31(35)30(26)34)24-14-16-25(17-15-24)29-21-20-28(32(36)33(29)37)23-12-10-22(8-4-2)11-13-23/h4,8,12,14-22H,3,5-7,9-11,13H2,1-2H3/b8-4+ |
| InChIKey | BBGFZWDKLGZWGX-XBXARRHUSA-N |
| XLogP | 10.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|