C38H42F4 — CID 67740072
1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene (PubChem CID 67740072) has the molecular formula C38H42F4 and a molecular weight of 574.75 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene.
| Compound Name | 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67740072 |
| Molecular Formula | C38H42F4 |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2,3-difluorobenzene |
| SMILES | C=CC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(CCCCCC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C38H42F4/c1-3-5-6-7-8-31-21-22-32(36(40)35(31)39)29-17-19-30(20-18-29)34-24-23-33(37(41)38(34)42)28-15-13-27(14-16-28)26-11-9-25(4-2)10-12-26/h4,15,17-27H,2-3,5-14,16H2,1H3 |
| InChIKey | NYTZNFXQIRLXHP-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|