C37H39F3O — CID 88998246
1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-1-enoxy]benzene (PubChem CID 88998246) has the molecular formula C37H39F3O and a molecular weight of 556.71 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-1-enoxy]benzene.
| Compound Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-1-enoxy]benzene |
|---|---|
| PubChem CID | 88998246 |
| Molecular Formula | C37H39F3O |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-3-fluorophenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-1-enoxy]benzene |
| SMILES | C=CC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(O/C=C\CCC)c(F)c5F)cc4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C37H39F3O/c1-3-5-6-23-41-35-22-21-33(36(39)37(35)40)30-17-13-28(14-18-30)31-19-20-32(34(38)24-31)29-15-11-27(12-16-29)26-9-7-25(4-2)8-10-26/h4,6,13-15,17-27H,2-3,5,7-12,16H2,1H3/b23-6- |
| InChIKey | DZQTVSPRZPJRBB-OUBWWKSTSA-N |
| XLogP | 11.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|