C33H33F3O — CID 67739029
1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-methoxybenzene (PubChem CID 67739029) has the molecular formula C33H33F3O and a molecular weight of 502.62 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-methoxybenzene.
| Compound Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 67739029 |
| Molecular Formula | C33H33F3O |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 1-[4-[4-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluorophenyl]phenyl]-2,3-difluoro-4-methoxybenzene |
| SMILES | C=CC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(OC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C33H33F3O/c1-3-21-4-6-22(7-5-21)23-8-10-24(11-9-23)27-16-17-28(30(34)20-27)25-12-14-26(15-13-25)29-18-19-31(37-2)33(36)32(29)35/h3,10,12-23H,1,4-9,11H2,2H3 |
| InChIKey | ANCFFNMJZHQCKR-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|