C30H29F3O — CID 67731204
1-butoxy-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene (PubChem CID 67731204) has the molecular formula C30H29F3O and a molecular weight of 462.56 g/mol. Its IUPAC name is 1-butoxy-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67731204 |
| Molecular Formula | C30H29F3O |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-butoxy-4-[4-[4-(4-ethenylcyclohexen-1-yl)-2-fluorophenyl]phenyl]-2,3-difluorobenzene |
| SMILES | C=CC1CC=C(c2ccc(-c3ccc(-c4ccc(OCCCC)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H29F3O/c1-3-5-18-34-28-17-16-26(29(32)30(28)33)23-12-10-22(11-13-23)25-15-14-24(19-27(25)31)21-8-6-20(4-2)7-9-21/h4,8,10-17,19-20H,2-3,5-7,9,18H2,1H3 |
| InChIKey | RGYMXKYURHCOFY-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|