C32H33F3O — CID 67731304
2,3-difluoro-1-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-propoxybenzene (PubChem CID 67731304) has the molecular formula C32H33F3O and a molecular weight of 490.61 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-propoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-propoxybenzene |
|---|---|
| PubChem CID | 67731304 |
| Molecular Formula | C32H33F3O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-propoxybenzene |
| SMILES | C/C=C/CCC1CC=C(c2ccc(-c3ccc(-c4ccc(OCCC)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H33F3O/c1-3-5-6-7-22-8-10-23(11-9-22)26-16-17-27(29(33)21-26)24-12-14-25(15-13-24)28-18-19-30(36-20-4-2)32(35)31(28)34/h3,5,10,12-19,21-22H,4,6-9,11,20H2,1-2H3/b5-3+ |
| InChIKey | MEMNRNKLCVAVOG-HWKANZROSA-N |
| XLogP | 9.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|