C29H27F3O — CID 67748414
2,3-difluoro-4-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]phenol (PubChem CID 67748414) has the molecular formula C29H27F3O and a molecular weight of 448.53 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]phenol.
| Compound Name | 2,3-difluoro-4-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]phenol |
|---|---|
| PubChem CID | 67748414 |
| Molecular Formula | C29H27F3O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2,3-difluoro-4-[4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]phenol |
| SMILES | C/C=C/CCC1CC=C(c2ccc(-c3ccc(-c4ccc(O)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H27F3O/c1-2-3-4-5-19-6-8-20(9-7-19)23-14-15-24(26(30)18-23)21-10-12-22(13-11-21)25-16-17-27(33)29(32)28(25)31/h2-3,8,10-19,33H,4-7,9H2,1H3/b3-2+ |
| InChIKey | WKSDHEZIBOMNHH-NSCUHMNNSA-N |
| XLogP | 8.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|